C28H26O9 — CID 4836530
[7-methyl-3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 2,6-dimethoxybenzoate (PubChem CID 4836530) has the molecular formula C28H26O9 and a molecular weight of 506.51 g/mol. Its IUPAC name is [7-methyl-3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 2,6-dimethoxybenzoate.
| Compound Name | [7-methyl-3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 4836530 |
| Molecular Formula | C28H26O9 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | [7-methyl-3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 2,6-dimethoxybenzoate |
| SMILES | COc1cc(C=C2Oc3c(ccc(OC(=O)c4c(OC)cccc4OC)c3C)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C28H26O9/c1-15-18(37-28(30)24-19(31-2)8-7-9-20(24)32-3)11-10-17-25(29)21(36-26(15)17)12-16-13-22(33-4)27(35-6)23(14-16)34-5/h7-14H,1-6H3 |
| InChIKey | OIZPSMUSQTWBQZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|