C23H24O7 — CID 110275235
ethyl 2-[[(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl]oxy]propanoate (PubChem CID 110275235) has the molecular formula C23H24O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is ethyl 2-[[(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl]oxy]propanoate.
| Compound Name | ethyl 2-[[(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl]oxy]propanoate |
|---|---|
| PubChem CID | 110275235 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | ethyl 2-[[(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl]oxy]propanoate |
| SMILES | CCOC(=O)C(C)Oc1ccc2c(c1C)O/C(=C\c1ccc(OC)c(OC)c1)C2=O |
| InChI | InChI=1S/C23H24O7/c1-6-28-23(25)14(3)29-17-10-8-16-21(24)20(30-22(16)13(17)2)12-15-7-9-18(26-4)19(11-15)27-5/h7-12,14H,6H2,1-5H3/b20-12- |
| InChIKey | DNNXEQUHOIKFNA-NDENLUEZSA-N |
| XLogP | 3.96 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|