C20H17ClO5 — CID 110275103
methyl 2-[[(2Z)-2-[(2-chlorophenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl]oxy]propanoate (PubChem CID 110275103) has the molecular formula C20H17ClO5 and a molecular weight of 372.80 g/mol. Its IUPAC name is methyl 2-[[(2Z)-2-[(2-chlorophenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl]oxy]propanoate.
| Compound Name | methyl 2-[[(2Z)-2-[(2-chlorophenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl]oxy]propanoate |
|---|---|
| PubChem CID | 110275103 |
| Molecular Formula | C20H17ClO5 |
| Molecular Weight | 372.80 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | methyl 2-[[(2Z)-2-[(2-chlorophenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl]oxy]propanoate |
| SMILES | COC(=O)C(C)Oc1ccc2c(c1C)O/C(=C\c1ccccc1Cl)C2=O |
| InChI | InChI=1S/C20H17ClO5/c1-11-16(25-12(2)20(23)24-3)9-8-14-18(22)17(26-19(11)14)10-13-6-4-5-7-15(13)21/h4-10,12H,1-3H3/b17-10- |
| InChIKey | QFFIBOTZPCAKTE-YVLHZVERSA-N |
| XLogP | 4.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.80 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|