C24H17BrCl2O4 — CID 95398598
(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-6-[(2,6-dichlorophenyl)methoxy]-7-methyl-1-benzofuran-3-one (PubChem CID 95398598) has the molecular formula C24H17BrCl2O4 and a molecular weight of 520.21 g/mol. Its IUPAC name is (2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-6-[(2,6-dichlorophenyl)methoxy]-7-methyl-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-6-[(2,6-dichlorophenyl)methoxy]-7-methyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 95398598 |
| Molecular Formula | C24H17BrCl2O4 |
| Molecular Weight | 520.21 g/mol |
| Exact Mass | 517.97 |
| IUPAC Name | (2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-6-[(2,6-dichlorophenyl)methoxy]-7-methyl-1-benzofuran-3-one |
| SMILES | COc1ccc(Br)cc1/C=C1\Oc2c(ccc(OCc3c(Cl)cccc3Cl)c2C)C1=O |
| InChI | InChI=1S/C24H17BrCl2O4/c1-13-20(30-12-17-18(26)4-3-5-19(17)27)9-7-16-23(28)22(31-24(13)16)11-14-10-15(25)6-8-21(14)29-2/h3-11H,12H2,1-2H3/b22-11- |
| InChIKey | BUBJOJROKVMDGX-JJFYIABZSA-N |
| XLogP | 7.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.21 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|