C16H10BrClO4 — CID 171642181
(2Z)-7-bromo-2-[(2-chloro-4-hydroxyphenyl)methylidene]-6-methoxy-1-benzofuran-3-one (PubChem CID 171642181) has the molecular formula C16H10BrClO4 and a molecular weight of 381.61 g/mol. Its IUPAC name is (2Z)-7-bromo-2-[(2-chloro-4-hydroxyphenyl)methylidene]-6-methoxy-1-benzofuran-3-one.
| Compound Name | (2Z)-7-bromo-2-[(2-chloro-4-hydroxyphenyl)methylidene]-6-methoxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 171642181 |
| Molecular Formula | C16H10BrClO4 |
| Molecular Weight | 381.61 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | (2Z)-7-bromo-2-[(2-chloro-4-hydroxyphenyl)methylidene]-6-methoxy-1-benzofuran-3-one |
| SMILES | COc1ccc2c(c1Br)O/C(=C\c1ccc(O)cc1Cl)C2=O |
| InChI | InChI=1S/C16H10BrClO4/c1-21-12-5-4-10-15(20)13(22-16(10)14(12)17)6-8-2-3-9(19)7-11(8)18/h2-7,19H,1H3/b13-6- |
| InChIKey | JTYXMEQSZICUCR-MLPAPPSSSA-N |
| XLogP | 4.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|