C15H8Cl2O3 — CID 943159
2-[(2,4-dichlorophenyl)methylidene]-6-hydroxy-1-benzofuran-3-one (PubChem CID 943159) has the molecular formula C15H8Cl2O3 and a molecular weight of 307.13 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylidene]-6-hydroxy-1-benzofuran-3-one.
| Compound Name | 2-[(2,4-dichlorophenyl)methylidene]-6-hydroxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 943159 |
| Molecular Formula | C15H8Cl2O3 |
| Molecular Weight | 307.13 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylidene]-6-hydroxy-1-benzofuran-3-one |
| SMILES | O=C1C(=Cc2ccc(Cl)cc2Cl)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C15H8Cl2O3/c16-9-2-1-8(12(17)6-9)5-14-15(19)11-4-3-10(18)7-13(11)20-14/h1-7,18H |
| InChIKey | BEWJBEULVJXHNS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.13 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|