C22H11BrCl2O4 — CID 5264446
[2-[(2,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-bromobenzoate (PubChem CID 5264446) has the molecular formula C22H11BrCl2O4 and a molecular weight of 490.14 g/mol. Its IUPAC name is [2-[(2,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-bromobenzoate.
| Compound Name | [2-[(2,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 5264446 |
| Molecular Formula | C22H11BrCl2O4 |
| Molecular Weight | 490.14 g/mol |
| Exact Mass | 487.92 |
| IUPAC Name | [2-[(2,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-bromobenzoate |
| SMILES | O=C(Oc1ccc2c(c1)OC(=Cc1ccc(Cl)cc1Cl)C2=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H11BrCl2O4/c23-14-4-1-12(2-5-14)22(27)28-16-7-8-17-19(11-16)29-20(21(17)26)9-13-3-6-15(24)10-18(13)25/h1-11H |
| InChIKey | XUXUBMUSLLHXOT-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.14 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|