C24H14Br2O6 — CID 95397691
[(2Z)-2-[(6-bromo-4H-1,3-benzodioxin-8-yl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-bromobenzoate (PubChem CID 95397691) has the molecular formula C24H14Br2O6 and a molecular weight of 558.18 g/mol. Its IUPAC name is [(2Z)-2-[(6-bromo-4H-1,3-benzodioxin-8-yl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-bromobenzoate.
| Compound Name | [(2Z)-2-[(6-bromo-4H-1,3-benzodioxin-8-yl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 95397691 |
| Molecular Formula | C24H14Br2O6 |
| Molecular Weight | 558.18 g/mol |
| Exact Mass | 555.92 |
| IUPAC Name | [(2Z)-2-[(6-bromo-4H-1,3-benzodioxin-8-yl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-bromobenzoate |
| SMILES | O=C(Oc1ccc2c(c1)O/C(=C\c1cc(Br)cc3c1OCOC3)C2=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H14Br2O6/c25-16-3-1-13(2-4-16)24(28)31-18-5-6-19-20(10-18)32-21(22(19)27)9-14-7-17(26)8-15-11-29-12-30-23(14)15/h1-10H,11-12H2/b21-9- |
| InChIKey | MTYSLZOFVVXSHN-NKVSQWTQSA-N |
| XLogP | 5.91 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.18 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|