C23H14O6 — CID 15480866
[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-3-oxo-1-benzofuran-6-yl] benzoate (PubChem CID 15480866) has the molecular formula C23H14O6 and a molecular weight of 386.36 g/mol. Its IUPAC name is [(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-3-oxo-1-benzofuran-6-yl] benzoate.
| Compound Name | [(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-3-oxo-1-benzofuran-6-yl] benzoate |
|---|---|
| PubChem CID | 15480866 |
| Molecular Formula | C23H14O6 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | [(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-3-oxo-1-benzofuran-6-yl] benzoate |
| SMILES | O=C(Oc1ccc2c(c1)O/C(=C\c1ccc3c(c1)OCO3)C2=O)c1ccccc1 |
| InChI | InChI=1S/C23H14O6/c24-22-17-8-7-16(28-23(25)15-4-2-1-3-5-15)12-19(17)29-21(22)11-14-6-9-18-20(10-14)27-13-26-18/h1-12H,13H2/b21-11- |
| InChIKey | TVJNCJMXUHXYLG-NHDPSOOVSA-N |
| XLogP | 4.25 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|