C20H15NO8 — CID 4965203
2-[[2-[[2-(1,3-benzodioxol-5-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]acetic acid (PubChem CID 4965203) has the molecular formula C20H15NO8 and a molecular weight of 397.34 g/mol. Its IUPAC name is 2-[[2-[[2-(1,3-benzodioxol-5-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-(1,3-benzodioxol-5-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 4965203 |
| Molecular Formula | C20H15NO8 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-[[2-[[2-(1,3-benzodioxol-5-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)COc1ccc2c(c1)OC(=Cc1ccc3c(c1)OCO3)C2=O |
| InChI | InChI=1S/C20H15NO8/c22-18(21-8-19(23)24)9-26-12-2-3-13-15(7-12)29-17(20(13)25)6-11-1-4-14-16(5-11)28-10-27-14/h1-7H,8-10H2,(H,21,22)(H,23,24) |
| InChIKey | IYRKRAYUTNONFM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|