C23H20NO8- — CID 40826043
(2S)-2-[[2-[[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]-3-methylbutanoate (PubChem CID 40826043) has the molecular formula C23H20NO8- and a molecular weight of 438.41 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]-3-methylbutanoate.
| Compound Name | (2S)-2-[[2-[[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 40826043 |
| Molecular Formula | C23H20NO8- |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (2S)-2-[[2-[[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)COc1ccc2c(c1)O/C(=C\c1ccc3c(c1)OCO3)C2=O)C(=O)[O-] |
| InChI | InChI=1S/C23H21NO8/c1-12(2)21(23(27)28)24-20(25)10-29-14-4-5-15-17(9-14)32-19(22(15)26)8-13-3-6-16-18(7-13)31-11-30-16/h3-9,12,21H,10-11H2,1-2H3,(H,24,25)(H,27,28)/p-1/b19-8-/t21-/m0/s1 |
| InChIKey | TVRFXZSVWQNWGQ-YMAYPHAPSA-M |
| XLogP | 1.30 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|