C25H19NO7 — CID 4901998
2-[[2-(1,3-benzodioxol-5-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]-N-(4-methoxyphenyl)acetamide (PubChem CID 4901998) has the molecular formula C25H19NO7 and a molecular weight of 445.43 g/mol. Its IUPAC name is 2-[[2-(1,3-benzodioxol-5-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[[2-(1,3-benzodioxol-5-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4901998 |
| Molecular Formula | C25H19NO7 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-[[2-(1,3-benzodioxol-5-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc3c(c2)OC(=Cc2ccc4c(c2)OCO4)C3=O)cc1 |
| InChI | InChI=1S/C25H19NO7/c1-29-17-5-3-16(4-6-17)26-24(27)13-30-18-7-8-19-21(12-18)33-23(25(19)28)11-15-2-9-20-22(10-15)32-14-31-20/h2-12H,13-14H2,1H3,(H,26,27) |
| InChIKey | IRWLJJYBGSHOQS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|