C19H16N2O8 — CID 4838978
2-[[2-[[2-[[2-(furan-2-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]acetyl]amino]acetic acid (PubChem CID 4838978) has the molecular formula C19H16N2O8 and a molecular weight of 400.34 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-(furan-2-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[[2-(furan-2-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 4838978 |
| Molecular Formula | C19H16N2O8 |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 2-[[2-[[2-[[2-(furan-2-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CNC(=O)COc1ccc2c(c1)OC(=Cc1ccco1)C2=O |
| InChI | InChI=1S/C19H16N2O8/c22-16(21-9-18(24)25)8-20-17(23)10-28-12-3-4-13-14(6-12)29-15(19(13)26)7-11-2-1-5-27-11/h1-7H,8-10H2,(H,20,23)(H,21,22)(H,24,25) |
| InChIKey | MDKUUCCMJQIQAD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 144.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|