C18H15NO6 — CID 943647
[(2Z)-2-(furan-2-ylmethylidene)-3-oxo-1-benzofuran-6-yl] morpholine-4-carboxylate (PubChem CID 943647) has the molecular formula C18H15NO6 and a molecular weight of 341.32 g/mol. Its IUPAC name is [(2Z)-2-(furan-2-ylmethylidene)-3-oxo-1-benzofuran-6-yl] morpholine-4-carboxylate.
| Compound Name | [(2Z)-2-(furan-2-ylmethylidene)-3-oxo-1-benzofuran-6-yl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 943647 |
| Molecular Formula | C18H15NO6 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [(2Z)-2-(furan-2-ylmethylidene)-3-oxo-1-benzofuran-6-yl] morpholine-4-carboxylate |
| SMILES | O=C1/C(=C/c2ccco2)Oc2cc(OC(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C18H15NO6/c20-17-14-4-3-13(24-18(21)19-5-8-22-9-6-19)11-15(14)25-16(17)10-12-2-1-7-23-12/h1-4,7,10-11H,5-6,8-9H2/b16-10- |
| InChIKey | IAPVZMOBFFPVBV-YBEGLDIGSA-N |
| XLogP | 2.73 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|