C26H17NO5 — CID 5009227
[2-(furan-2-ylmethylidene)-3-oxo-1-benzofuran-6-yl] N,N-diphenylcarbamate (PubChem CID 5009227) has the molecular formula C26H17NO5 and a molecular weight of 423.42 g/mol. Its IUPAC name is [2-(furan-2-ylmethylidene)-3-oxo-1-benzofuran-6-yl] N,N-diphenylcarbamate.
| Compound Name | [2-(furan-2-ylmethylidene)-3-oxo-1-benzofuran-6-yl] N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 5009227 |
| Molecular Formula | C26H17NO5 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | [2-(furan-2-ylmethylidene)-3-oxo-1-benzofuran-6-yl] N,N-diphenylcarbamate |
| SMILES | O=C1C(=Cc2ccco2)Oc2cc(OC(=O)N(c3ccccc3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C26H17NO5/c28-25-22-14-13-21(17-23(22)32-24(25)16-20-12-7-15-30-20)31-26(29)27(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-17H |
| InChIKey | LUCVLDBHXUFWMP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|