C27H18N2O4 — CID 3512764
[3-oxo-2-(pyridin-3-ylmethylidene)-1-benzofuran-6-yl] N,N-diphenylcarbamate (PubChem CID 3512764) has the molecular formula C27H18N2O4 and a molecular weight of 434.45 g/mol. Its IUPAC name is [3-oxo-2-(pyridin-3-ylmethylidene)-1-benzofuran-6-yl] N,N-diphenylcarbamate.
| Compound Name | [3-oxo-2-(pyridin-3-ylmethylidene)-1-benzofuran-6-yl] N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 3512764 |
| Molecular Formula | C27H18N2O4 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | [3-oxo-2-(pyridin-3-ylmethylidene)-1-benzofuran-6-yl] N,N-diphenylcarbamate |
| SMILES | O=C1C(=Cc2cccnc2)Oc2cc(OC(=O)N(c3ccccc3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C27H18N2O4/c30-26-23-14-13-22(17-24(23)33-25(26)16-19-8-7-15-28-18-19)32-27(31)29(20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-18H |
| InChIKey | IUMGQZBDXQQQEU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|