C31H21NO6 — CID 3952799
[3-oxo-2-(pyridin-3-ylmethylidene)-1-benzofuran-6-yl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate (PubChem CID 3952799) has the molecular formula C31H21NO6 and a molecular weight of 503.51 g/mol. Its IUPAC name is [3-oxo-2-(pyridin-3-ylmethylidene)-1-benzofuran-6-yl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate.
| Compound Name | [3-oxo-2-(pyridin-3-ylmethylidene)-1-benzofuran-6-yl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 3952799 |
| Molecular Formula | C31H21NO6 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | [3-oxo-2-(pyridin-3-ylmethylidene)-1-benzofuran-6-yl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate |
| SMILES | Cc1oc2ccc(OCc3ccccc3)cc2c1C(=O)Oc1ccc2c(c1)OC(=Cc1cccnc1)C2=O |
| InChI | InChI=1S/C31H21NO6/c1-19-29(25-15-22(10-12-26(25)36-19)35-18-20-6-3-2-4-7-20)31(34)37-23-9-11-24-27(16-23)38-28(30(24)33)14-21-8-5-13-32-17-21/h2-17H,18H2,1H3 |
| InChIKey | NAFNERMWKTVNCQ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|