C28H22O6 — CID 6198958
[(2Z)-2-[(3-methylphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 6198958) has the molecular formula C28H22O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is [(2Z)-2-[(3-methylphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | [(2Z)-2-[(3-methylphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6198958 |
| Molecular Formula | C28H22O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | [(2Z)-2-[(3-methylphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CCOc1ccc2oc(C)c(C(=O)Oc3ccc4c(c3)O/C(=C\c3cccc(C)c3)C4=O)c2c1 |
| InChI | InChI=1S/C28H22O6/c1-4-31-19-9-11-23-22(14-19)26(17(3)32-23)28(30)33-20-8-10-21-24(15-20)34-25(27(21)29)13-18-7-5-6-16(2)12-18/h5-15H,4H2,1-3H3/b25-13- |
| InChIKey | DBLLXCUAHBBJEZ-MXAYSNPKSA-N |
| XLogP | 6.28 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|