C27H18Cl2O6 — CID 6198966
[(2Z)-2-[(3,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 6198966) has the molecular formula C27H18Cl2O6 and a molecular weight of 509.34 g/mol. Its IUPAC name is [(2Z)-2-[(3,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | [(2Z)-2-[(3,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6198966 |
| Molecular Formula | C27H18Cl2O6 |
| Molecular Weight | 509.34 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | [(2Z)-2-[(3,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CCOc1ccc2oc(C)c(C(=O)Oc3ccc4c(c3)O/C(=C\c3ccc(Cl)c(Cl)c3)C4=O)c2c1 |
| InChI | InChI=1S/C27H18Cl2O6/c1-3-32-16-6-9-22-19(12-16)25(14(2)33-22)27(31)34-17-5-7-18-23(13-17)35-24(26(18)30)11-15-4-8-20(28)21(29)10-15/h4-13H,3H2,1-2H3/b24-11- |
| InChIKey | OMWWSJFMWMIXGW-MYKKPKGFSA-N |
| XLogP | 7.28 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.34 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|