C32H21BrO6 — CID 6198979
[(2Z)-2-[(4-bromophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate (PubChem CID 6198979) has the molecular formula C32H21BrO6 and a molecular weight of 581.42 g/mol. Its IUPAC name is [(2Z)-2-[(4-bromophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate.
| Compound Name | [(2Z)-2-[(4-bromophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6198979 |
| Molecular Formula | C32H21BrO6 |
| Molecular Weight | 581.42 g/mol |
| Exact Mass | 580.05 |
| IUPAC Name | [(2Z)-2-[(4-bromophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate |
| SMILES | Cc1oc2ccc(OCc3ccccc3)cc2c1C(=O)Oc1ccc2c(c1)O/C(=C\c1ccc(Br)cc1)C2=O |
| InChI | InChI=1S/C32H21BrO6/c1-19-30(26-16-23(12-14-27(26)37-19)36-18-21-5-3-2-4-6-21)32(35)38-24-11-13-25-28(17-24)39-29(31(25)34)15-20-7-9-22(33)10-8-20/h2-17H,18H2,1H3/b29-15- |
| InChIKey | QXAXWMJDOPARAF-FDVSRXAVSA-N |
| XLogP | 7.92 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.42 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|