C27H19FO6 — CID 4729614
[2-[(3-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 4729614) has the molecular formula C27H19FO6 and a molecular weight of 458.44 g/mol. Its IUPAC name is [2-[(3-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | [2-[(3-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 4729614 |
| Molecular Formula | C27H19FO6 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | [2-[(3-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CCOc1ccc2oc(C)c(C(=O)Oc3ccc4c(c3)OC(=Cc3cccc(F)c3)C4=O)c2c1 |
| InChI | InChI=1S/C27H19FO6/c1-3-31-18-8-10-22-21(13-18)25(15(2)32-22)27(30)33-19-7-9-20-23(14-19)34-24(26(20)29)12-16-5-4-6-17(28)11-16/h4-14H,3H2,1-2H3 |
| InChIKey | VTUBPTNSZRVOBF-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|