C34H26O7 — CID 19260999
[(2Z)-2-[(4-ethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate (PubChem CID 19260999) has the molecular formula C34H26O7 and a molecular weight of 546.58 g/mol. Its IUPAC name is [(2Z)-2-[(4-ethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate.
| Compound Name | [(2Z)-2-[(4-ethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 19260999 |
| Molecular Formula | C34H26O7 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | [(2Z)-2-[(4-ethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylate |
| SMILES | CCOc1ccc(/C=C2\Oc3cc(OC(=O)c4c(C)oc5ccc(OCc6ccccc6)cc45)ccc3C2=O)cc1 |
| InChI | InChI=1S/C34H26O7/c1-3-37-24-11-9-22(10-12-24)17-31-33(35)27-15-13-26(19-30(27)41-31)40-34(36)32-21(2)39-29-16-14-25(18-28(29)32)38-20-23-7-5-4-6-8-23/h4-19H,3,20H2,1-2H3/b31-17- |
| InChIKey | LSLQBVPHWILYJY-LJUMEUDFSA-N |
| XLogP | 7.55 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|