C30H23NO6 — CID 18836015
[2-methoxy-4-[(Z)-(6-methoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] N,N-diphenylcarbamate (PubChem CID 18836015) has the molecular formula C30H23NO6 and a molecular weight of 493.52 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-(6-methoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] N,N-diphenylcarbamate.
| Compound Name | [2-methoxy-4-[(Z)-(6-methoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 18836015 |
| Molecular Formula | C30H23NO6 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | [2-methoxy-4-[(Z)-(6-methoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] N,N-diphenylcarbamate |
| SMILES | COc1ccc2c(c1)O/C(=C\c1ccc(OC(=O)N(c3ccccc3)c3ccccc3)c(OC)c1)C2=O |
| InChI | InChI=1S/C30H23NO6/c1-34-23-14-15-24-26(19-23)36-28(29(24)32)18-20-13-16-25(27(17-20)35-2)37-30(33)31(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-19H,1-2H3/b28-18- |
| InChIKey | JTTDQPQOYMVWMT-VEILYXNESA-N |
| XLogP | 6.66 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|