C23H18O7S — CID 2027424
[(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] benzenesulfonate (PubChem CID 2027424) has the molecular formula C23H18O7S and a molecular weight of 438.46 g/mol. Its IUPAC name is [(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] benzenesulfonate.
| Compound Name | [(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] benzenesulfonate |
|---|---|
| PubChem CID | 2027424 |
| Molecular Formula | C23H18O7S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | [(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] benzenesulfonate |
| SMILES | COc1ccc(/C=C2\Oc3cc(OS(=O)(=O)c4ccccc4)ccc3C2=O)cc1OC |
| InChI | InChI=1S/C23H18O7S/c1-27-19-11-8-15(12-21(19)28-2)13-22-23(24)18-10-9-16(14-20(18)29-22)30-31(25,26)17-6-4-3-5-7-17/h3-14H,1-2H3/b22-13- |
| InChIKey | PNBCGFWIJYVHOD-XKZIYDEJSA-N |
| XLogP | 4.09 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|