C34H23NO4 — CID 6535709
[(2Z)-3-oxo-2-[(4-phenylphenyl)methylidene]-1-benzofuran-6-yl] N,N-diphenylcarbamate (PubChem CID 6535709) has the molecular formula C34H23NO4 and a molecular weight of 509.56 g/mol. Its IUPAC name is [(2Z)-3-oxo-2-[(4-phenylphenyl)methylidene]-1-benzofuran-6-yl] N,N-diphenylcarbamate.
| Compound Name | [(2Z)-3-oxo-2-[(4-phenylphenyl)methylidene]-1-benzofuran-6-yl] N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 6535709 |
| Molecular Formula | C34H23NO4 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | [(2Z)-3-oxo-2-[(4-phenylphenyl)methylidene]-1-benzofuran-6-yl] N,N-diphenylcarbamate |
| SMILES | O=C1/C(=C/c2ccc(-c3ccccc3)cc2)Oc2cc(OC(=O)N(c3ccccc3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C34H23NO4/c36-33-30-21-20-29(38-34(37)35(27-12-6-2-7-13-27)28-14-8-3-9-15-28)23-31(30)39-32(33)22-24-16-18-26(19-17-24)25-10-4-1-5-11-25/h1-23H/b32-22- |
| InChIKey | RYHNXMKXAOLMAZ-JDCMOKTRSA-N |
| XLogP | 8.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|