C32H23NO5 — CID 163065208
[2-[[(2S)-2-methyl-2H-chromen-3-yl]methylidene]-3-oxo-1-benzofuran-6-yl] N,N-diphenylcarbamate (PubChem CID 163065208) has the molecular formula C32H23NO5 and a molecular weight of 501.54 g/mol. Its IUPAC name is [2-[[(2S)-2-methyl-2H-chromen-3-yl]methylidene]-3-oxo-1-benzofuran-6-yl] N,N-diphenylcarbamate.
| Compound Name | [2-[[(2S)-2-methyl-2H-chromen-3-yl]methylidene]-3-oxo-1-benzofuran-6-yl] N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 163065208 |
| Molecular Formula | C32H23NO5 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | [2-[[(2S)-2-methyl-2H-chromen-3-yl]methylidene]-3-oxo-1-benzofuran-6-yl] N,N-diphenylcarbamate |
| SMILES | C[C@@H]1Oc2ccccc2C=C1C=C1Oc2cc(OC(=O)N(c3ccccc3)c3ccccc3)ccc2C1=O |
| InChI | InChI=1S/C32H23NO5/c1-21-23(18-22-10-8-9-15-28(22)36-21)19-30-31(34)27-17-16-26(20-29(27)38-30)37-32(35)33(24-11-4-2-5-12-24)25-13-6-3-7-14-25/h2-21H,1H3/t21-/m0/s1 |
| InChIKey | QXYULVYWWWASHY-NRFANRHFSA-N |
| XLogP | 7.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|