C28H22O4 — CID 163081626
2-[[(2R)-2-methyl-2H-chromen-3-yl]methylidene]-6-(3-phenylprop-2-enoxy)-1-benzofuran-3-one (PubChem CID 163081626) has the molecular formula C28H22O4 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-[[(2R)-2-methyl-2H-chromen-3-yl]methylidene]-6-(3-phenylprop-2-enoxy)-1-benzofuran-3-one.
| Compound Name | 2-[[(2R)-2-methyl-2H-chromen-3-yl]methylidene]-6-(3-phenylprop-2-enoxy)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 163081626 |
| Molecular Formula | C28H22O4 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-[[(2R)-2-methyl-2H-chromen-3-yl]methylidene]-6-(3-phenylprop-2-enoxy)-1-benzofuran-3-one |
| SMILES | C[C@H]1Oc2ccccc2C=C1C=C1Oc2cc(OCC=Cc3ccccc3)ccc2C1=O |
| InChI | InChI=1S/C28H22O4/c1-19-22(16-21-11-5-6-12-25(21)31-19)17-27-28(29)24-14-13-23(18-26(24)32-27)30-15-7-10-20-8-3-2-4-9-20/h2-14,16-19H,15H2,1H3/t19-/m1/s1 |
| InChIKey | XJCFVHQRPKCYFF-LJQANCHMSA-N |
| XLogP | 6.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|