C28H22O7 — CID 163040422
[2-[[(2R)-2-methyl-2H-chromen-3-yl]methylidene]-3-oxo-1-benzofuran-6-yl] 3,5-dimethoxybenzoate (PubChem CID 163040422) has the molecular formula C28H22O7 and a molecular weight of 470.48 g/mol. Its IUPAC name is [2-[[(2R)-2-methyl-2H-chromen-3-yl]methylidene]-3-oxo-1-benzofuran-6-yl] 3,5-dimethoxybenzoate.
| Compound Name | [2-[[(2R)-2-methyl-2H-chromen-3-yl]methylidene]-3-oxo-1-benzofuran-6-yl] 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 163040422 |
| Molecular Formula | C28H22O7 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | [2-[[(2R)-2-methyl-2H-chromen-3-yl]methylidene]-3-oxo-1-benzofuran-6-yl] 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)Oc2ccc3c(c2)OC(=CC2=Cc4ccccc4O[C@@H]2C)C3=O)c1 |
| InChI | InChI=1S/C28H22O7/c1-16-18(10-17-6-4-5-7-24(17)33-16)13-26-27(29)23-9-8-20(15-25(23)35-26)34-28(30)19-11-21(31-2)14-22(12-19)32-3/h4-16H,1-3H3/t16-/m1/s1 |
| InChIKey | WEZVXOOBHREKHT-MRXNPFEDSA-N |
| XLogP | 5.25 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|