C27H24O5 — CID 6315635
[(2Z)-2-[(2-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-tert-butylbenzoate (PubChem CID 6315635) has the molecular formula C27H24O5 and a molecular weight of 428.48 g/mol. Its IUPAC name is [(2Z)-2-[(2-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-tert-butylbenzoate.
| Compound Name | [(2Z)-2-[(2-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 6315635 |
| Molecular Formula | C27H24O5 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [(2Z)-2-[(2-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-tert-butylbenzoate |
| SMILES | COc1ccccc1/C=C1\Oc2cc(OC(=O)c3ccc(C(C)(C)C)cc3)ccc2C1=O |
| InChI | InChI=1S/C27H24O5/c1-27(2,3)19-11-9-17(10-12-19)26(29)31-20-13-14-21-23(16-20)32-24(25(21)28)15-18-7-5-6-8-22(18)30-4/h5-16H,1-4H3/b24-15- |
| InChIKey | VORRFCFVZVPCSS-IWIPYMOSSA-N |
| XLogP | 5.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|