C24H17FO6 — CID 3601167
[2-[(2-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 2,6-dimethoxybenzoate (PubChem CID 3601167) has the molecular formula C24H17FO6 and a molecular weight of 420.39 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 2,6-dimethoxybenzoate.
| Compound Name | [2-[(2-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 3601167 |
| Molecular Formula | C24H17FO6 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | [2-[(2-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 2,6-dimethoxybenzoate |
| SMILES | COc1cccc(OC)c1C(=O)Oc1ccc2c(c1)OC(=Cc1ccccc1F)C2=O |
| InChI | InChI=1S/C24H17FO6/c1-28-18-8-5-9-19(29-2)22(18)24(27)30-15-10-11-16-20(13-15)31-21(23(16)26)12-14-6-3-4-7-17(14)25/h3-13H,1-2H3 |
| InChIKey | XXEAHEQUZSYJFF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|