C27H19BrO5 — CID 4886182
6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(2-methyl-2H-chromen-3-yl)methylidene]-1-benzofuran-3-one (PubChem CID 4886182) has the molecular formula C27H19BrO5 and a molecular weight of 503.35 g/mol. Its IUPAC name is 6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(2-methyl-2H-chromen-3-yl)methylidene]-1-benzofuran-3-one.
| Compound Name | 6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(2-methyl-2H-chromen-3-yl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 4886182 |
| Molecular Formula | C27H19BrO5 |
| Molecular Weight | 503.35 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | 6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(2-methyl-2H-chromen-3-yl)methylidene]-1-benzofuran-3-one |
| SMILES | CC1Oc2ccccc2C=C1C=C1Oc2cc(OCC(=O)c3ccc(Br)cc3)ccc2C1=O |
| InChI | InChI=1S/C27H19BrO5/c1-16-19(12-18-4-2-3-5-24(18)32-16)13-26-27(30)22-11-10-21(14-25(22)33-26)31-15-23(29)17-6-8-20(28)9-7-17/h2-14,16H,15H2,1H3 |
| InChIKey | CXKJPYWCHNVNCU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.35 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|