C20H19NO4 — CID 5264966
(2-benzylidene-3-oxo-1-benzofuran-6-yl) N,N-diethylcarbamate (PubChem CID 5264966) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is (2-benzylidene-3-oxo-1-benzofuran-6-yl) N,N-diethylcarbamate.
| Compound Name | (2-benzylidene-3-oxo-1-benzofuran-6-yl) N,N-diethylcarbamate |
|---|---|
| PubChem CID | 5264966 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (2-benzylidene-3-oxo-1-benzofuran-6-yl) N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc2c(c1)OC(=Cc1ccccc1)C2=O |
| InChI | InChI=1S/C20H19NO4/c1-3-21(4-2)20(23)24-15-10-11-16-17(13-15)25-18(19(16)22)12-14-8-6-5-7-9-14/h5-13H,3-4H2,1-2H3 |
| InChIKey | RLCCCYQPWZKEIS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|