C26H22O4 — CID 2021474
[(2E)-3-oxo-2-[(4-phenylphenyl)methylidene]-1-benzofuran-6-yl] 2,2-dimethylpropanoate (PubChem CID 2021474) has the molecular formula C26H22O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is [(2E)-3-oxo-2-[(4-phenylphenyl)methylidene]-1-benzofuran-6-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2E)-3-oxo-2-[(4-phenylphenyl)methylidene]-1-benzofuran-6-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 2021474 |
| Molecular Formula | C26H22O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | [(2E)-3-oxo-2-[(4-phenylphenyl)methylidene]-1-benzofuran-6-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc2c(c1)O/C(=C/c1ccc(-c3ccccc3)cc1)C2=O |
| InChI | InChI=1S/C26H22O4/c1-26(2,3)25(28)29-20-13-14-21-22(16-20)30-23(24(21)27)15-17-9-11-19(12-10-17)18-7-5-4-6-8-18/h4-16H,1-3H3/b23-15+ |
| InChIKey | DQYJVKPUKODMLQ-HZHRSRAPSA-N |
| XLogP | 5.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|