C22H21NO7 — CID 4911833
6-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethoxy]-2-(furan-2-ylmethylidene)-1-benzofuran-3-one (PubChem CID 4911833) has the molecular formula C22H21NO7 and a molecular weight of 411.41 g/mol. Its IUPAC name is 6-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethoxy]-2-(furan-2-ylmethylidene)-1-benzofuran-3-one.
| Compound Name | 6-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethoxy]-2-(furan-2-ylmethylidene)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 4911833 |
| Molecular Formula | C22H21NO7 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 6-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethoxy]-2-(furan-2-ylmethylidene)-1-benzofuran-3-one |
| SMILES | O=C1C(=Cc2ccco2)Oc2cc(OCC(=O)N3CCC4(CC3)OCCO4)ccc21 |
| InChI | InChI=1S/C22H21NO7/c24-20(23-7-5-22(6-8-23)28-10-11-29-22)14-27-16-3-4-17-18(12-16)30-19(21(17)25)13-15-2-1-9-26-15/h1-4,9,12-13H,5-8,10-11,14H2 |
| InChIKey | NGBNFSKHXYZRHA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 87.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|