C23H17NO7 — CID 4973742
methyl 2-[[2-[[2-(furan-2-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]benzoate (PubChem CID 4973742) has the molecular formula C23H17NO7 and a molecular weight of 419.39 g/mol. Its IUPAC name is methyl 2-[[2-[[2-(furan-2-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[[2-(furan-2-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 4973742 |
| Molecular Formula | C23H17NO7 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | methyl 2-[[2-[[2-(furan-2-ylmethylidene)-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)COc1ccc2c(c1)OC(=Cc1ccco1)C2=O |
| InChI | InChI=1S/C23H17NO7/c1-28-23(27)16-6-2-3-7-18(16)24-21(25)13-30-15-8-9-17-19(11-15)31-20(22(17)26)12-14-5-4-10-29-14/h2-12H,13H2,1H3,(H,24,25) |
| InChIKey | YXEGCJRUVAGYMF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|