C27H25NO8 — CID 4908567
N-(2,4-dimethoxyphenyl)-2-[[2-[(2,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetamide (PubChem CID 4908567) has the molecular formula C27H25NO8 and a molecular weight of 491.50 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[[2-[(2,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[[2-[(2,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetamide |
|---|---|
| PubChem CID | 4908567 |
| Molecular Formula | C27H25NO8 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[[2-[(2,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetamide |
| SMILES | COc1ccc(C=C2Oc3cc(OCC(=O)Nc4ccc(OC)cc4OC)ccc3C2=O)c(OC)c1 |
| InChI | InChI=1S/C27H25NO8/c1-31-17-6-5-16(22(12-17)33-3)11-25-27(30)20-9-7-19(14-23(20)36-25)35-15-26(29)28-21-10-8-18(32-2)13-24(21)34-4/h5-14H,15H2,1-4H3,(H,28,29) |
| InChIKey | DOHVJMSWGKVVTP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|