C24H26N2O6 — CID 4908450
2-[(2,5-dimethoxyphenyl)methylidene]-6-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]-1-benzofuran-3-one (PubChem CID 4908450) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)methylidene]-6-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]-1-benzofuran-3-one.
| Compound Name | 2-[(2,5-dimethoxyphenyl)methylidene]-6-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 4908450 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)methylidene]-6-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]-1-benzofuran-3-one |
| SMILES | COc1ccc(OC)c(C=C2Oc3cc(OCC(=O)N4CCN(C)CC4)ccc3C2=O)c1 |
| InChI | InChI=1S/C24H26N2O6/c1-25-8-10-26(11-9-25)23(27)15-31-18-4-6-19-21(14-18)32-22(24(19)28)13-16-12-17(29-2)5-7-20(16)30-3/h4-7,12-14H,8-11,15H2,1-3H3 |
| InChIKey | FSBQLBRMIVFNSQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|