C24H15F5O5 — CID 5266097
2-[(2,5-dimethoxyphenyl)methylidene]-6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1-benzofuran-3-one (PubChem CID 5266097) has the molecular formula C24H15F5O5 and a molecular weight of 478.37 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)methylidene]-6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1-benzofuran-3-one.
| Compound Name | 2-[(2,5-dimethoxyphenyl)methylidene]-6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 5266097 |
| Molecular Formula | C24H15F5O5 |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)methylidene]-6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1-benzofuran-3-one |
| SMILES | COc1ccc(OC)c(C=C2Oc3cc(OCc4c(F)c(F)c(F)c(F)c4F)ccc3C2=O)c1 |
| InChI | InChI=1S/C24H15F5O5/c1-31-12-4-6-16(32-2)11(7-12)8-18-24(30)14-5-3-13(9-17(14)34-18)33-10-15-19(25)21(27)23(29)22(28)20(15)26/h3-9H,10H2,1-2H3 |
| InChIKey | MVORLSJFYDTKTB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|