C21H10F5NO3 — CID 4861169
6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-2-(pyridin-4-ylmethylidene)-1-benzofuran-3-one (PubChem CID 4861169) has the molecular formula C21H10F5NO3 and a molecular weight of 419.31 g/mol. Its IUPAC name is 6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-2-(pyridin-4-ylmethylidene)-1-benzofuran-3-one.
| Compound Name | 6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-2-(pyridin-4-ylmethylidene)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 4861169 |
| Molecular Formula | C21H10F5NO3 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-2-(pyridin-4-ylmethylidene)-1-benzofuran-3-one |
| SMILES | O=C1C(=Cc2ccncc2)Oc2cc(OCc3c(F)c(F)c(F)c(F)c3F)ccc21 |
| InChI | InChI=1S/C21H10F5NO3/c22-16-13(17(23)19(25)20(26)18(16)24)9-29-11-1-2-12-14(8-11)30-15(21(12)28)7-10-3-5-27-6-4-10/h1-8H,9H2 |
| InChIKey | FKHSOYUSOUBVJM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|