C22H14Cl2O3 — CID 19261053
(2Z)-2-benzylidene-6-[(2,6-dichlorophenyl)methoxy]-1-benzofuran-3-one (PubChem CID 19261053) has the molecular formula C22H14Cl2O3 and a molecular weight of 397.26 g/mol. Its IUPAC name is (2Z)-2-benzylidene-6-[(2,6-dichlorophenyl)methoxy]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-benzylidene-6-[(2,6-dichlorophenyl)methoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 19261053 |
| Molecular Formula | C22H14Cl2O3 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | (2Z)-2-benzylidene-6-[(2,6-dichlorophenyl)methoxy]-1-benzofuran-3-one |
| SMILES | O=C1/C(=C/c2ccccc2)Oc2cc(OCc3c(Cl)cccc3Cl)ccc21 |
| InChI | InChI=1S/C22H14Cl2O3/c23-18-7-4-8-19(24)17(18)13-26-15-9-10-16-20(12-15)27-21(22(16)25)11-14-5-2-1-3-6-14/h1-12H,13H2/b21-11- |
| InChIKey | YQDFCCSAHDKOPY-NHDPSOOVSA-N |
| XLogP | 6.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|