C21H13Cl2NO3 — CID 2005834
(2Z)-6-[(2,6-dichlorophenyl)methoxy]-2-(pyridin-4-ylmethylidene)-1-benzofuran-3-one (PubChem CID 2005834) has the molecular formula C21H13Cl2NO3 and a molecular weight of 398.25 g/mol. Its IUPAC name is (2Z)-6-[(2,6-dichlorophenyl)methoxy]-2-(pyridin-4-ylmethylidene)-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[(2,6-dichlorophenyl)methoxy]-2-(pyridin-4-ylmethylidene)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 2005834 |
| Molecular Formula | C21H13Cl2NO3 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | (2Z)-6-[(2,6-dichlorophenyl)methoxy]-2-(pyridin-4-ylmethylidene)-1-benzofuran-3-one |
| SMILES | O=C1/C(=C/c2ccncc2)Oc2cc(OCc3c(Cl)cccc3Cl)ccc21 |
| InChI | InChI=1S/C21H13Cl2NO3/c22-17-2-1-3-18(23)16(17)12-26-14-4-5-15-19(11-14)27-20(21(15)25)10-13-6-8-24-9-7-13/h1-11H,12H2/b20-10- |
| InChIKey | RXLDFXRPNXERJQ-JMIUGGIZSA-N |
| XLogP | 5.58 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|