C24H16O6 — CID 2008183
[(2E)-2-[(4-methylphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 1,3-benzodioxole-5-carboxylate (PubChem CID 2008183) has the molecular formula C24H16O6 and a molecular weight of 400.39 g/mol. Its IUPAC name is [(2E)-2-[(4-methylphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [(2E)-2-[(4-methylphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 2008183 |
| Molecular Formula | C24H16O6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | [(2E)-2-[(4-methylphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 1,3-benzodioxole-5-carboxylate |
| SMILES | Cc1ccc(/C=C2/Oc3cc(OC(=O)c4ccc5c(c4)OCO5)ccc3C2=O)cc1 |
| InChI | InChI=1S/C24H16O6/c1-14-2-4-15(5-3-14)10-22-23(25)18-8-7-17(12-20(18)30-22)29-24(26)16-6-9-19-21(11-16)28-13-27-19/h2-12H,13H2,1H3/b22-10+ |
| InChIKey | UGVCTGGUEVKDSZ-LSHDLFTRSA-N |
| XLogP | 4.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|