C15H6Cl4O2 — CID 5085004
5,7-dichloro-2-[(2,4-dichlorophenyl)methylidene]-1-benzofuran-3-one (PubChem CID 5085004) has the molecular formula C15H6Cl4O2 and a molecular weight of 360.02 g/mol. Its IUPAC name is 5,7-dichloro-2-[(2,4-dichlorophenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 5,7-dichloro-2-[(2,4-dichlorophenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 5085004 |
| Molecular Formula | C15H6Cl4O2 |
| Molecular Weight | 360.02 g/mol |
| Exact Mass | 357.91 |
| IUPAC Name | 5,7-dichloro-2-[(2,4-dichlorophenyl)methylidene]-1-benzofuran-3-one |
| SMILES | O=C1C(=Cc2ccc(Cl)cc2Cl)Oc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C15H6Cl4O2/c16-8-2-1-7(11(18)5-8)3-13-14(20)10-4-9(17)6-12(19)15(10)21-13/h1-6H |
| InChIKey | AWBWELFHBWCXCB-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.02 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|