C27H23BrO8 — CID 95397764
[(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 3,4,5-trimethoxybenzoate (PubChem CID 95397764) has the molecular formula C27H23BrO8 and a molecular weight of 555.38 g/mol. Its IUPAC name is [(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 3,4,5-trimethoxybenzoate.
| Compound Name | [(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 95397764 |
| Molecular Formula | C27H23BrO8 |
| Molecular Weight | 555.38 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | [(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1ccc(Br)cc1/C=C1\Oc2c(ccc(OC(=O)c3cc(OC)c(OC)c(OC)c3)c2C)C1=O |
| InChI | InChI=1S/C27H23BrO8/c1-14-19(36-27(30)16-12-22(32-3)26(34-5)23(13-16)33-4)9-7-18-24(29)21(35-25(14)18)11-15-10-17(28)6-8-20(15)31-2/h6-13H,1-5H3/b21-11- |
| InChIKey | CGZIVCDMCGGLMT-NHDPSOOVSA-N |
| XLogP | 5.63 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.38 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|