C24H16Br2O5 — CID 95397683
[(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 4-bromobenzoate (PubChem CID 95397683) has the molecular formula C24H16Br2O5 and a molecular weight of 544.20 g/mol. Its IUPAC name is [(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 4-bromobenzoate.
| Compound Name | [(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 95397683 |
| Molecular Formula | C24H16Br2O5 |
| Molecular Weight | 544.20 g/mol |
| Exact Mass | 541.94 |
| IUPAC Name | [(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 4-bromobenzoate |
| SMILES | COc1ccc(Br)cc1/C=C1\Oc2cc(OC(=O)c3ccc(Br)cc3)cc(C)c2C1=O |
| InChI | InChI=1S/C24H16Br2O5/c1-13-9-18(30-24(28)14-3-5-16(25)6-4-14)12-20-22(13)23(27)21(31-20)11-15-10-17(26)7-8-19(15)29-2/h3-12H,1-2H3/b21-11- |
| InChIKey | GCOZLCJIAONGLJ-NHDPSOOVSA-N |
| XLogP | 6.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.20 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|