C23H17BrClNO6 — CID 95398555
[(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 3-(3-chloro-1,2-oxazol-5-yl)propanoate (PubChem CID 95398555) has the molecular formula C23H17BrClNO6 and a molecular weight of 518.75 g/mol. Its IUPAC name is [(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 3-(3-chloro-1,2-oxazol-5-yl)propanoate.
| Compound Name | [(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 3-(3-chloro-1,2-oxazol-5-yl)propanoate |
|---|---|
| PubChem CID | 95398555 |
| Molecular Formula | C23H17BrClNO6 |
| Molecular Weight | 518.75 g/mol |
| Exact Mass | 516.99 |
| IUPAC Name | [(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 3-(3-chloro-1,2-oxazol-5-yl)propanoate |
| SMILES | COc1ccc(Br)cc1/C=C1\Oc2cc(OC(=O)CCc3cc(Cl)no3)cc(C)c2C1=O |
| InChI | InChI=1S/C23H17BrClNO6/c1-12-7-16(30-21(27)6-4-15-11-20(25)26-32-15)10-18-22(12)23(28)19(31-18)9-13-8-14(24)3-5-17(13)29-2/h3,5,7-11H,4,6H2,1-2H3/b19-9- |
| InChIKey | GEEWGWPXIGBFMW-OCKHKDLRSA-N |
| XLogP | 5.56 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.75 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|