C27H19BrO7 — CID 95398411
[(2Z)-2-[(2,3-dimethoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate (PubChem CID 95398411) has the molecular formula C27H19BrO7 and a molecular weight of 535.35 g/mol. Its IUPAC name is [(2Z)-2-[(2,3-dimethoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate.
| Compound Name | [(2Z)-2-[(2,3-dimethoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 95398411 |
| Molecular Formula | C27H19BrO7 |
| Molecular Weight | 535.35 g/mol |
| Exact Mass | 534.03 |
| IUPAC Name | [(2Z)-2-[(2,3-dimethoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate |
| SMILES | COc1cccc(/C=C2\Oc3cc(OC(=O)c4cc5cc(Br)ccc5o4)cc(C)c3C2=O)c1OC |
| InChI | InChI=1S/C27H19BrO7/c1-14-9-18(33-27(30)23-12-16-10-17(28)7-8-19(16)34-23)13-21-24(14)25(29)22(35-21)11-15-5-4-6-20(31-2)26(15)32-3/h4-13H,1-3H3/b22-11- |
| InChIKey | HRYHCWKYIDXCEZ-JJFYIABZSA-N |
| XLogP | 6.36 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.35 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|