C25H14BrNO7 — CID 95398408
[(2Z)-4-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate (PubChem CID 95398408) has the molecular formula C25H14BrNO7 and a molecular weight of 520.29 g/mol. Its IUPAC name is [(2Z)-4-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate.
| Compound Name | [(2Z)-4-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 95398408 |
| Molecular Formula | C25H14BrNO7 |
| Molecular Weight | 520.29 g/mol |
| Exact Mass | 519.00 |
| IUPAC Name | [(2Z)-4-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate |
| SMILES | Cc1cc(OC(=O)c2cc3cc(Br)ccc3o2)cc2c1C(=O)/C(=C/c1ccc([N+](=O)[O-])cc1)O2 |
| InChI | InChI=1S/C25H14BrNO7/c1-13-8-18(32-25(29)22-11-15-10-16(26)4-7-19(15)33-22)12-20-23(13)24(28)21(34-20)9-14-2-5-17(6-3-14)27(30)31/h2-12H,1H3/b21-9- |
| InChIKey | HLDACJWWMCCXJV-NKVSQWTQSA-N |
| XLogP | 6.25 |
| TPSA | 108.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.29 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|