C25H13BrClFO5 — CID 95398395
[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate (PubChem CID 95398395) has the molecular formula C25H13BrClFO5 and a molecular weight of 527.73 g/mol. Its IUPAC name is [(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate.
| Compound Name | [(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 95398395 |
| Molecular Formula | C25H13BrClFO5 |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 525.96 |
| IUPAC Name | [(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate |
| SMILES | Cc1cc(OC(=O)c2cc3cc(Br)ccc3o2)cc2c1C(=O)/C(=C/c1c(F)cccc1Cl)O2 |
| InChI | InChI=1S/C25H13BrClFO5/c1-12-7-15(31-25(30)22-9-13-8-14(26)5-6-19(13)32-22)10-20-23(12)24(29)21(33-20)11-16-17(27)3-2-4-18(16)28/h2-11H,1H3/b21-11- |
| InChIKey | JPJQLKAYXXXJMR-NHDPSOOVSA-N |
| XLogP | 7.13 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|