C27H19BrO6 — CID 95398401
[(2Z)-2-[(4-ethoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate (PubChem CID 95398401) has the molecular formula C27H19BrO6 and a molecular weight of 519.35 g/mol. Its IUPAC name is [(2Z)-2-[(4-ethoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate.
| Compound Name | [(2Z)-2-[(4-ethoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 95398401 |
| Molecular Formula | C27H19BrO6 |
| Molecular Weight | 519.35 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | [(2Z)-2-[(4-ethoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 5-bromo-1-benzofuran-2-carboxylate |
| SMILES | CCOc1ccc(/C=C2\Oc3cc(OC(=O)c4cc5cc(Br)ccc5o4)cc(C)c3C2=O)cc1 |
| InChI | InChI=1S/C27H19BrO6/c1-3-31-19-7-4-16(5-8-19)11-23-26(29)25-15(2)10-20(14-22(25)34-23)32-27(30)24-13-17-12-18(28)6-9-21(17)33-24/h4-14H,3H2,1-2H3/b23-11- |
| InChIKey | LSKIITAWXNFMML-KSEXSDGBSA-N |
| XLogP | 6.74 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.35 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|